About 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid
2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid (PubChem CID 130458232) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid.
Analyze 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid?
The IUPAC name of 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid (CID 130458232) is 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid is CN1C=C(CC(N)C(=O)O)NN1.
What is the InChIKey of 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid?
The InChIKey is YCFQZTYUFKTNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2/c1-10-3-4(8-9-10)2-5(7)6(11)12/h3,5,8-9H,2,7H2,1H3,(H,11,12).
What are the key properties of 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid?
2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid has a molecular weight of 172.19 g/mol, XLogP of -1.42, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3-methyl-1,2-dihydrotriazol-5-yl)propanoic acid is sourced from PubChem (CID 130458232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).