C9H12N2O2 — CID 55282394
2-amino-3-(5-methyl-3-pyridinyl)propanoic acid (PubChem CID 55282394) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-amino-3-(5-methyl-3-pyridinyl)propanoic acid.
| Compound Name | 2-amino-3-(5-methyl-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 55282394 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-amino-3-(5-methyl-3-pyridinyl)propanoic acid |
| SMILES | Cc1cncc(CC(N)C(=O)O)c1 |
| InChI | InChI=1S/C9H12N2O2/c1-6-2-7(5-11-4-6)3-8(10)9(12)13/h2,4-5,8H,3,10H2,1H3,(H,12,13) |
| InChIKey | CPKQBVYCIFWHTC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |