C9H14Cl2N2O2 — CID 162344222
(2R)-2-amino-3-(5-methyl-3-pyridinyl)propanoic acid;dihydrochloride (PubChem CID 162344222) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is (2R)-2-amino-3-(5-methyl-3-pyridinyl)propanoic acid;dihydrochloride.
| Compound Name | (2R)-2-amino-3-(5-methyl-3-pyridinyl)propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 162344222 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (2R)-2-amino-3-(5-methyl-3-pyridinyl)propanoic acid;dihydrochloride |
| SMILES | Cc1cncc(C[C@@H](N)C(=O)O)c1.Cl.Cl |
| InChI | InChI=1S/C9H12N2O2.2ClH/c1-6-2-7(5-11-4-6)3-8(10)9(12)13;;/h2,4-5,8H,3,10H2,1H3,(H,12,13);2*1H/t8-;;/m1../s1 |
| InChIKey | JJKLYQLSLGCWKK-YCBDHFTFSA-N |
| XLogP | 1.19 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |