C8H11N3O2 — CID 55283262
2-amino-3-(5-amino-3-pyridinyl)propanoic acid (PubChem CID 55283262) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-amino-3-(5-amino-3-pyridinyl)propanoic acid.
| Compound Name | 2-amino-3-(5-amino-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 55283262 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-amino-3-(5-amino-3-pyridinyl)propanoic acid |
| SMILES | Nc1cncc(CC(N)C(=O)O)c1 |
| InChI | InChI=1S/C8H11N3O2/c9-6-1-5(3-11-4-6)2-7(10)8(12)13/h1,3-4,7H,2,9-10H2,(H,12,13) |
| InChIKey | HMPIUHLYMRKTTH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |