C8H10N2O2S — CID 139022717
2-amino-3-(5-sulfanyl-3-pyridinyl)propanoic acid (PubChem CID 139022717) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-amino-3-(5-sulfanyl-3-pyridinyl)propanoic acid.
| Compound Name | 2-amino-3-(5-sulfanyl-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 139022717 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-amino-3-(5-sulfanyl-3-pyridinyl)propanoic acid |
| SMILES | NC(Cc1cncc(S)c1)C(=O)O |
| InChI | InChI=1S/C8H10N2O2S/c9-7(8(11)12)2-5-1-6(13)4-10-3-5/h1,3-4,7,13H,2,9H2,(H,11,12) |
| InChIKey | SQXZECFEWUBFQR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|