C20H29N3O6S — CID 135220300
N-[(1R)-1-[3-(cyclopropylmethoxy)phenyl]ethyl]-2-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethoxy]ethanesulfonamide (PubChem CID 135220300) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[(1R)-1-[3-(cyclopropylmethoxy)phenyl]ethyl]-2-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethoxy]ethanesulfonamide.
| Compound Name | N-[(1R)-1-[3-(cyclopropylmethoxy)phenyl]ethyl]-2-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethoxy]ethanesulfonamide |
|---|---|
| PubChem CID | 135220300 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[(1R)-1-[3-(cyclopropylmethoxy)phenyl]ethyl]-2-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethoxy]ethanesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCOCCN1CCC(=O)NC1=O)c1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C20H29N3O6S/c1-15(17-3-2-4-18(13-17)29-14-16-5-6-16)22-30(26,27)12-11-28-10-9-23-8-7-19(24)21-20(23)25/h2-4,13,15-16,22H,5-12,14H2,1H3,(H,21,24,25)/t15-/m1/s1 |
| InChIKey | OHVUHHQBTBIHGG-OAHLLOKOSA-N |
| XLogP | 1.41 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|