C20H28N2O6S — CID 157454422
1-[2-[4-[3-(cyclopropylmethoxy)phenyl]sulfonylbutoxy]ethyl]-1,3-diazinane-2,4-dione (PubChem CID 157454422) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[2-[4-[3-(cyclopropylmethoxy)phenyl]sulfonylbutoxy]ethyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-[4-[3-(cyclopropylmethoxy)phenyl]sulfonylbutoxy]ethyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 157454422 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-[2-[4-[3-(cyclopropylmethoxy)phenyl]sulfonylbutoxy]ethyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(CCOCCCCS(=O)(=O)c2cccc(OCC3CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C20H28N2O6S/c23-19-8-9-22(20(24)21-19)10-12-27-11-1-2-13-29(25,26)18-5-3-4-17(14-18)28-15-16-6-7-16/h3-5,14,16H,1-2,6-13,15H2,(H,21,23,24) |
| InChIKey | NMRJDHHMFDZIHO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|