C20H27N3O6S — CID 153447198
1-[3-[1-[3-(cyclopropylmethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxypropyl]imidazolidine-2,4-dione (PubChem CID 153447198) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-[3-[1-[3-(cyclopropylmethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxypropyl]imidazolidine-2,4-dione.
| Compound Name | 1-[3-[1-[3-(cyclopropylmethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxypropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 153447198 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-[3-[1-[3-(cyclopropylmethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxypropyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(CCCOC2CCN(S(=O)(=O)c3cccc(OCC4CC4)c3)C2)C(=O)N1 |
| InChI | InChI=1S/C20H27N3O6S/c24-19-13-22(20(25)21-19)8-2-10-28-17-7-9-23(12-17)30(26,27)18-4-1-3-16(11-18)29-14-15-5-6-15/h1,3-4,11,15,17H,2,5-10,12-14H2,(H,21,24,25) |
| InChIKey | IQCNFPMHHDHIRP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|