C19H29N3O5S — CID 158116112
1-[5-[2-[4-(cyclopropylmethoxy)-1H-pyrrol-2-yl]propylsulfonyl]pentyl]imidazolidine-2,4-dione (PubChem CID 158116112) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-[5-[2-[4-(cyclopropylmethoxy)-1H-pyrrol-2-yl]propylsulfonyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[4-(cyclopropylmethoxy)-1H-pyrrol-2-yl]propylsulfonyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 158116112 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[5-[2-[4-(cyclopropylmethoxy)-1H-pyrrol-2-yl]propylsulfonyl]pentyl]imidazolidine-2,4-dione |
| SMILES | CC(CS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1cc(OCC2CC2)c[nH]1 |
| InChI | InChI=1S/C19H29N3O5S/c1-14(17-9-16(10-20-17)27-12-15-5-6-15)13-28(25,26)8-4-2-3-7-22-11-18(23)21-19(22)24/h9-10,14-15,20H,2-8,11-13H2,1H3,(H,21,23,24) |
| InChIKey | FRAFQGYUWAOION-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|