C21H31N3O4S — CID 162531923
1-[3-(cyclopropylmethoxy)phenyl]sulfanylpiperidine;1-(3-hydroxypropyl)imidazolidine-2,4-dione (PubChem CID 162531923) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)phenyl]sulfanylpiperidine;1-(3-hydroxypropyl)imidazolidine-2,4-dione.
| Compound Name | 1-[3-(cyclopropylmethoxy)phenyl]sulfanylpiperidine;1-(3-hydroxypropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162531923 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)phenyl]sulfanylpiperidine;1-(3-hydroxypropyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(CCCO)C(=O)N1.c1cc(OCC2CC2)cc(SN2CCCCC2)c1 |
| InChI | InChI=1S/C15H21NOS.C6H10N2O3/c1-2-9-16(10-3-1)18-15-6-4-5-14(11-15)17-12-13-7-8-13;9-3-1-2-8-4-5(10)7-6(8)11/h4-6,11,13H,1-3,7-10,12H2;9H,1-4H2,(H,7,10,11) |
| InChIKey | VZHDQOICSCIUQI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|