C18H25N3O6S — CID 134542844
3-(cyclopropylmethoxy)-N-[3-[2-(2,4-dioxoimidazolidin-1-yl)ethoxy]propyl]benzenesulfonamide (PubChem CID 134542844) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-[3-[2-(2,4-dioxoimidazolidin-1-yl)ethoxy]propyl]benzenesulfonamide.
| Compound Name | 3-(cyclopropylmethoxy)-N-[3-[2-(2,4-dioxoimidazolidin-1-yl)ethoxy]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134542844 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-[3-[2-(2,4-dioxoimidazolidin-1-yl)ethoxy]propyl]benzenesulfonamide |
| SMILES | O=C1CN(CCOCCCNS(=O)(=O)c2cccc(OCC3CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C18H25N3O6S/c22-17-12-21(18(23)20-17)8-10-26-9-2-7-19-28(24,25)16-4-1-3-15(11-16)27-13-14-5-6-14/h1,3-4,11,14,19H,2,5-10,12-13H2,(H,20,22,23) |
| InChIKey | SLYOSIAJMVBDCU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|