C17H23F2N3O5S — CID 146230379
3-(2,2-difluoroethoxy)-N-[6-(2,4-dioxoimidazolidin-1-yl)hexyl]benzenesulfonamide (PubChem CID 146230379) has the molecular formula C17H23F2N3O5S and a molecular weight of 419.45 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[6-(2,4-dioxoimidazolidin-1-yl)hexyl]benzenesulfonamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[6-(2,4-dioxoimidazolidin-1-yl)hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146230379 |
| Molecular Formula | C17H23F2N3O5S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[6-(2,4-dioxoimidazolidin-1-yl)hexyl]benzenesulfonamide |
| SMILES | O=C1CN(CCCCCCNS(=O)(=O)c2cccc(OCC(F)F)c2)C(=O)N1 |
| InChI | InChI=1S/C17H23F2N3O5S/c18-15(19)12-27-13-6-5-7-14(10-13)28(25,26)20-8-3-1-2-4-9-22-11-16(23)21-17(22)24/h5-7,10,15,20H,1-4,8-9,11-12H2,(H,21,23,24) |
| InChIKey | RNEAEXDWJOIMLJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|