C25H30N4O5S — CID 146230429
3-cyclopentyloxy-N-[3-[4-[(2,4-dioxoimidazolidin-1-yl)methyl]phenyl]-1-methylazetidin-3-yl]benzenesulfonamide (PubChem CID 146230429) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-[3-[4-[(2,4-dioxoimidazolidin-1-yl)methyl]phenyl]-1-methylazetidin-3-yl]benzenesulfonamide.
| Compound Name | 3-cyclopentyloxy-N-[3-[4-[(2,4-dioxoimidazolidin-1-yl)methyl]phenyl]-1-methylazetidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 146230429 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-cyclopentyloxy-N-[3-[4-[(2,4-dioxoimidazolidin-1-yl)methyl]phenyl]-1-methylazetidin-3-yl]benzenesulfonamide |
| SMILES | CN1CC(NS(=O)(=O)c2cccc(OC3CCCC3)c2)(c2ccc(CN3CC(=O)NC3=O)cc2)C1 |
| InChI | InChI=1S/C25H30N4O5S/c1-28-16-25(17-28,19-11-9-18(10-12-19)14-29-15-23(30)26-24(29)31)27-35(32,33)22-8-4-7-21(13-22)34-20-5-2-3-6-20/h4,7-13,20,27H,2-3,5-6,14-17H2,1H3,(H,26,30,31) |
| InChIKey | XZEGOGGNBVTCNO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|