C19H22N4O5S2 — CID 146229837
3-cyclopentyloxy-N-[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-1,3-thiazol-2-yl]methyl]benzenesulfonamide (PubChem CID 146229837) has the molecular formula C19H22N4O5S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-1,3-thiazol-2-yl]methyl]benzenesulfonamide.
| Compound Name | 3-cyclopentyloxy-N-[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-1,3-thiazol-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146229837 |
| Molecular Formula | C19H22N4O5S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 3-cyclopentyloxy-N-[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-1,3-thiazol-2-yl]methyl]benzenesulfonamide |
| SMILES | O=C1CN(Cc2cnc(CNS(=O)(=O)c3cccc(OC4CCCC4)c3)s2)C(=O)N1 |
| InChI | InChI=1S/C19H22N4O5S2/c24-17-12-23(19(25)22-17)11-15-9-20-18(29-15)10-21-30(26,27)16-7-3-6-14(8-16)28-13-4-1-2-5-13/h3,6-9,13,21H,1-2,4-5,10-12H2,(H,22,24,25) |
| InChIKey | MSSMRESWMSFPGP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|