C18H18F2N4O5S — CID 146230403
3-(2,2-difluoroethoxy)-N-[[6-[(2,4-dioxoimidazolidin-1-yl)methyl]-3-pyridinyl]methyl]benzenesulfonamide (PubChem CID 146230403) has the molecular formula C18H18F2N4O5S and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[[6-[(2,4-dioxoimidazolidin-1-yl)methyl]-3-pyridinyl]methyl]benzenesulfonamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[[6-[(2,4-dioxoimidazolidin-1-yl)methyl]-3-pyridinyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146230403 |
| Molecular Formula | C18H18F2N4O5S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[[6-[(2,4-dioxoimidazolidin-1-yl)methyl]-3-pyridinyl]methyl]benzenesulfonamide |
| SMILES | O=C1CN(Cc2ccc(CNS(=O)(=O)c3cccc(OCC(F)F)c3)cn2)C(=O)N1 |
| InChI | InChI=1S/C18H18F2N4O5S/c19-16(20)11-29-14-2-1-3-15(6-14)30(27,28)22-8-12-4-5-13(21-7-12)9-24-10-17(25)23-18(24)26/h1-7,16,22H,8-11H2,(H,23,25,26) |
| InChIKey | PNVQTZUWQSEQKP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|