C21H25FN4O2S — CID 134556429
1-[[6-[[2-[3-(2-fluoropropoxy)phenyl]ethylamino]methyl]-3-pyridinyl]methyl]-4-sulfanylideneimidazolidin-2-one (PubChem CID 134556429) has the molecular formula C21H25FN4O2S and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-[[6-[[2-[3-(2-fluoropropoxy)phenyl]ethylamino]methyl]-3-pyridinyl]methyl]-4-sulfanylideneimidazolidin-2-one.
| Compound Name | 1-[[6-[[2-[3-(2-fluoropropoxy)phenyl]ethylamino]methyl]-3-pyridinyl]methyl]-4-sulfanylideneimidazolidin-2-one |
|---|---|
| PubChem CID | 134556429 |
| Molecular Formula | C21H25FN4O2S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[[6-[[2-[3-(2-fluoropropoxy)phenyl]ethylamino]methyl]-3-pyridinyl]methyl]-4-sulfanylideneimidazolidin-2-one |
| SMILES | CC(F)COc1cccc(CCNCc2ccc(CN3CC(=S)NC3=O)cn2)c1 |
| InChI | InChI=1S/C21H25FN4O2S/c1-15(22)14-28-19-4-2-3-16(9-19)7-8-23-11-18-6-5-17(10-24-18)12-26-13-20(29)25-21(26)27/h2-6,9-10,15,23H,7-8,11-14H2,1H3,(H,25,27,29) |
| InChIKey | DMVKLWBQVSBYJQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|