C14H18N4O4S2 — CID 55627731
3-N-[[6-(dimethylamino)-3-pyridinyl]methyl]benzene-1,3-disulfonamide (PubChem CID 55627731) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-N-[[6-(dimethylamino)-3-pyridinyl]methyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[[6-(dimethylamino)-3-pyridinyl]methyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55627731 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-N-[[6-(dimethylamino)-3-pyridinyl]methyl]benzene-1,3-disulfonamide |
| SMILES | CN(C)c1ccc(CNS(=O)(=O)c2cccc(S(N)(=O)=O)c2)cn1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-18(2)14-7-6-11(9-16-14)10-17-24(21,22)13-5-3-4-12(8-13)23(15,19)20/h3-9,17H,10H2,1-2H3,(H2,15,19,20) |
| InChIKey | IKXWGPMIYJKXFL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |