C16H21N5O3S — CID 119465589
N-[3-(2-aminoethylsulfamoyl)phenyl]-6-(dimethylamino)pyridine-3-carboxamide (PubChem CID 119465589) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-6-(dimethylamino)pyridine-3-carboxamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-6-(dimethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119465589 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-6-(dimethylamino)pyridine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2cccc(S(=O)(=O)NCCN)c2)cn1 |
| InChI | InChI=1S/C16H21N5O3S/c1-21(2)15-7-6-12(11-18-15)16(22)20-13-4-3-5-14(10-13)25(23,24)19-9-8-17/h3-7,10-11,19H,8-9,17H2,1-2H3,(H,20,22) |
| InChIKey | VDZNZIGHWPTCJO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |