C18H23N3O3S2 — CID 119465571
N-[3-(2-aminoethylsulfamoyl)phenyl]-4-(ethylsulfanylmethyl)benzamide (PubChem CID 119465571) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-4-(ethylsulfanylmethyl)benzamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-4-(ethylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 119465571 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-4-(ethylsulfanylmethyl)benzamide |
| SMILES | CCSCc1ccc(C(=O)Nc2cccc(S(=O)(=O)NCCN)c2)cc1 |
| InChI | InChI=1S/C18H23N3O3S2/c1-2-25-13-14-6-8-15(9-7-14)18(22)21-16-4-3-5-17(12-16)26(23,24)20-11-10-19/h3-9,12,20H,2,10-11,13,19H2,1H3,(H,21,22) |
| InChIKey | KKXIYHOAUDWMAD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |