C15H16F3N3O3S — CID 55642240
N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 55642240) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 55642240 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(C)c1cc(CNS(=O)(=O)c2cccc(OC(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C15H16F3N3O3S/c1-21(2)14-8-11(6-7-19-14)10-20-25(22,23)13-5-3-4-12(9-13)24-15(16,17)18/h3-9,20H,10H2,1-2H3 |
| InChIKey | ITCLGDRNOFXKJT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |