C17H18F3N3O4S — CID 35390128
N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 35390128) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 35390128 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1N1CCOCC1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3O4S/c18-17(19,20)27-14-4-1-5-15(11-14)28(24,25)22-12-13-3-2-6-21-16(13)23-7-9-26-10-8-23/h1-6,11,22H,7-10,12H2 |
| InChIKey | RCQVXKRWZUNONO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |