C20H20F3N3O3 — CID 39568621
(E)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 39568621) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is (E)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 39568621 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (E)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)(F)F)NCc1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C20H20F3N3O3/c21-20(22,23)29-17-6-2-1-4-15(17)7-8-18(27)25-14-16-5-3-9-24-19(16)26-10-12-28-13-11-26/h1-9H,10-14H2,(H,25,27)/b8-7+ |
| InChIKey | JBZACHYNZRPISH-BQYQJAHWSA-N |
| XLogP | 3.15 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|