C17H22N4O4S2 — CID 55913757
3-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]benzene-1,3-disulfonamide (PubChem CID 55913757) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55913757 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NCc2ccc(N3CCCCC3)nc2)c1 |
| InChI | InChI=1S/C17H22N4O4S2/c18-26(22,23)15-5-4-6-16(11-15)27(24,25)20-13-14-7-8-17(19-12-14)21-9-2-1-3-10-21/h4-8,11-12,20H,1-3,9-10,13H2,(H2,18,22,23) |
| InChIKey | PXYIEFOVBQKPPD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |