C17H17ClN4O2S — CID 55703524
3-chloro-4-cyano-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]benzenesulfonamide (PubChem CID 55703524) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55703524 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-chloro-4-cyano-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCc2ccc(N3CCCC3)nc2)cc1Cl |
| InChI | InChI=1S/C17H17ClN4O2S/c18-16-9-15(5-4-14(16)10-19)25(23,24)21-12-13-3-6-17(20-11-13)22-7-1-2-8-22/h3-6,9,11,21H,1-2,7-8,12H2 |
| InChIKey | YNTSRPCAFNUSDM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |