C19H23ClN4O3S — CID 38529778
3-[(3-chlorophenyl)sulfonylamino]-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]propanamide (PubChem CID 38529778) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfonylamino]-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]propanamide.
| Compound Name | 3-[(3-chlorophenyl)sulfonylamino]-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 38529778 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(Cl)c1)NCc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C19H23ClN4O3S/c20-16-4-3-5-17(12-16)28(26,27)23-9-8-19(25)22-14-15-6-7-18(21-13-15)24-10-1-2-11-24/h3-7,12-13,23H,1-2,8-11,14H2,(H,22,25) |
| InChIKey | GWROBQTXWDZXOB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |