C18H19ClF3N3O2S — CID 55914778
2-chloro-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 55914778) has the molecular formula C18H19ClF3N3O2S and a molecular weight of 433.88 g/mol. Its IUPAC name is 2-chloro-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55914778 |
| Molecular Formula | C18H19ClF3N3O2S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-chloro-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(N2CCCCC2)nc1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H19ClF3N3O2S/c19-15-6-5-14(18(20,21)22)10-16(15)28(26,27)24-12-13-4-7-17(23-11-13)25-8-2-1-3-9-25/h4-7,10-11,24H,1-3,8-9,12H2 |
| InChIKey | VZAQNTRKDBLSCC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |