C13H12F2N2O3S — CID 3823851
N-[[4-(difluoromethoxy)phenyl]methyl]pyridine-3-sulfonamide (PubChem CID 3823851) has the molecular formula C13H12F2N2O3S and a molecular weight of 314.31 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]pyridine-3-sulfonamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 3823851 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(OC(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C13H12F2N2O3S/c14-13(15)20-11-5-3-10(4-6-11)8-17-21(18,19)12-2-1-7-16-9-12/h1-7,9,13,17H,8H2 |
| InChIKey | NXBMHFJLPSRQCF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |