C12H18F2N2O3S — CID 31076489
1-[(diethylsulfamoylamino)methyl]-4-(difluoromethoxy)benzene (PubChem CID 31076489) has the molecular formula C12H18F2N2O3S and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-[(diethylsulfamoylamino)methyl]-4-(difluoromethoxy)benzene.
| Compound Name | 1-[(diethylsulfamoylamino)methyl]-4-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 31076489 |
| Molecular Formula | C12H18F2N2O3S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[(diethylsulfamoylamino)methyl]-4-(difluoromethoxy)benzene |
| SMILES | CCN(CC)S(=O)(=O)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H18F2N2O3S/c1-3-16(4-2)20(17,18)15-9-10-5-7-11(8-6-10)19-12(13)14/h5-8,12,15H,3-4,9H2,1-2H3 |
| InChIKey | LILXRTSXNWXQHX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |