C19H25F2N3O5S — CID 135198047
3-(2,2-difluoroethoxy)-N-[(E)-7-(2,4-dioxoimidazolidin-1-yl)-2-methylhept-6-en-2-yl]benzenesulfonamide (PubChem CID 135198047) has the molecular formula C19H25F2N3O5S and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[(E)-7-(2,4-dioxoimidazolidin-1-yl)-2-methylhept-6-en-2-yl]benzenesulfonamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[(E)-7-(2,4-dioxoimidazolidin-1-yl)-2-methylhept-6-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135198047 |
| Molecular Formula | C19H25F2N3O5S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[(E)-7-(2,4-dioxoimidazolidin-1-yl)-2-methylhept-6-en-2-yl]benzenesulfonamide |
| SMILES | CC(C)(CCC/C=C/N1CC(=O)NC1=O)NS(=O)(=O)c1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C19H25F2N3O5S/c1-19(2,9-4-3-5-10-24-12-17(25)22-18(24)26)23-30(27,28)15-8-6-7-14(11-15)29-13-16(20)21/h5-8,10-11,16,23H,3-4,9,12-13H2,1-2H3,(H,22,25,26)/b10-5+ |
| InChIKey | FASFQXKGPXCKCY-BJMVGYQFSA-N |
| XLogP | 2.62 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|