C22H35N3O5S — CID 135198022
5-(2,4-dioxoimidazolidin-1-yl)-N-[(1S)-1-[2-methyl-5-(2-methylbutoxy)phenyl]ethyl]pentane-1-sulfonamide (PubChem CID 135198022) has the molecular formula C22H35N3O5S and a molecular weight of 453.61 g/mol. Its IUPAC name is 5-(2,4-dioxoimidazolidin-1-yl)-N-[(1S)-1-[2-methyl-5-(2-methylbutoxy)phenyl]ethyl]pentane-1-sulfonamide.
| Compound Name | 5-(2,4-dioxoimidazolidin-1-yl)-N-[(1S)-1-[2-methyl-5-(2-methylbutoxy)phenyl]ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 135198022 |
| Molecular Formula | C22H35N3O5S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 5-(2,4-dioxoimidazolidin-1-yl)-N-[(1S)-1-[2-methyl-5-(2-methylbutoxy)phenyl]ethyl]pentane-1-sulfonamide |
| SMILES | CCC(C)COc1ccc(C)c([C@H](C)NS(=O)(=O)CCCCCN2CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H35N3O5S/c1-5-16(2)15-30-19-10-9-17(3)20(13-19)18(4)24-31(28,29)12-8-6-7-11-25-14-21(26)23-22(25)27/h9-10,13,16,18,24H,5-8,11-12,14-15H2,1-4H3,(H,23,26,27)/t16?,18-/m0/s1 |
| InChIKey | CJDBKNBJKPYCHJ-DAFXYXGESA-N |
| XLogP | 3.12 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|