C20H30FN5O4S — CID 134553976
5-(2,4-dioxoimidazolidin-1-yl)-N-[(1R)-1-(4-fluoro-3-piperazin-1-ylphenyl)ethyl]pentane-1-sulfonamide (PubChem CID 134553976) has the molecular formula C20H30FN5O4S and a molecular weight of 455.56 g/mol. Its IUPAC name is 5-(2,4-dioxoimidazolidin-1-yl)-N-[(1R)-1-(4-fluoro-3-piperazin-1-ylphenyl)ethyl]pentane-1-sulfonamide.
| Compound Name | 5-(2,4-dioxoimidazolidin-1-yl)-N-[(1R)-1-(4-fluoro-3-piperazin-1-ylphenyl)ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134553976 |
| Molecular Formula | C20H30FN5O4S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 5-(2,4-dioxoimidazolidin-1-yl)-N-[(1R)-1-(4-fluoro-3-piperazin-1-ylphenyl)ethyl]pentane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1ccc(F)c(N2CCNCC2)c1 |
| InChI | InChI=1S/C20H30FN5O4S/c1-15(16-5-6-17(21)18(13-16)25-10-7-22-8-11-25)24-31(29,30)12-4-2-3-9-26-14-19(27)23-20(26)28/h5-6,13,15,22,24H,2-4,7-12,14H2,1H3,(H,23,27,28)/t15-/m1/s1 |
| InChIKey | BIQDHJQQRKLBDD-OAHLLOKOSA-N |
| XLogP | 0.94 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|