C21H28FN3O7S — CID 134544015
3-[5-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoyl]pentyl]-2,5-dioxoimidazolidine-1-carboxylic acid (PubChem CID 134544015) has the molecular formula C21H28FN3O7S and a molecular weight of 485.53 g/mol. Its IUPAC name is 3-[5-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoyl]pentyl]-2,5-dioxoimidazolidine-1-carboxylic acid.
| Compound Name | 3-[5-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoyl]pentyl]-2,5-dioxoimidazolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 134544015 |
| Molecular Formula | C21H28FN3O7S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-[5-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoyl]pentyl]-2,5-dioxoimidazolidine-1-carboxylic acid |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCN1CC(=O)N(C(=O)O)C1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H28FN3O7S/c1-14(16-7-8-17(22)18(11-16)32-13-15-5-6-15)23-33(30,31)10-4-2-3-9-24-12-19(26)25(20(24)27)21(28)29/h7-8,11,14-15,23H,2-6,9-10,12-13H2,1H3,(H,28,29)/t14-/m1/s1 |
| InChIKey | JCGFMEYKRVLQQH-CQSZACIVSA-N |
| XLogP | 2.71 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|