C26H38FN5O6S — CID 158668283
1-[(2R)-1-[3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidin-1-yl]-1-oxopropan-2-yl]-1-methylguanidine (PubChem CID 158668283) has the molecular formula C26H38FN5O6S and a molecular weight of 567.68 g/mol. Its IUPAC name is 1-[(2R)-1-[3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidin-1-yl]-1-oxopropan-2-yl]-1-methylguanidine.
| Compound Name | 1-[(2R)-1-[3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidin-1-yl]-1-oxopropan-2-yl]-1-methylguanidine |
|---|---|
| PubChem CID | 158668283 |
| Molecular Formula | C26H38FN5O6S |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 1-[(2R)-1-[3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidin-1-yl]-1-oxopropan-2-yl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)[C@H](C)C(=O)N1C(=O)CN(CCCCCS(=O)(=O)C[C@H](C)c2ccc(F)c(OCC3CC3)c2)C1=O |
| InChI | InChI=1S/C26H38FN5O6S/c1-17(20-9-10-21(27)22(13-20)38-15-19-7-8-19)16-39(36,37)12-6-4-5-11-31-14-23(33)32(26(31)35)24(34)18(2)30(3)25(28)29/h9-10,13,17-19H,4-8,11-12,14-16H2,1-3H3,(H3,28,29)/t17-,18+/m0/s1 |
| InChIKey | XIGASPQCRGTQAJ-ZWKOTPCHSA-N |
| XLogP | 2.31 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|