C19H27F2N3O5S — CID 155370304
N-[(1S)-1-(2,4-difluoro-3-propoxyphenyl)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155370304) has the molecular formula C19H27F2N3O5S and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluoro-3-propoxyphenyl)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1S)-1-(2,4-difluoro-3-propoxyphenyl)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155370304 |
| Molecular Formula | C19H27F2N3O5S |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(1S)-1-(2,4-difluoro-3-propoxyphenyl)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | CCCOc1c(F)ccc([C@H](C)NS(=O)(=O)CCCCCN2CC(=O)NC2=O)c1F |
| InChI | InChI=1S/C19H27F2N3O5S/c1-3-10-29-18-15(20)8-7-14(17(18)21)13(2)23-30(27,28)11-6-4-5-9-24-12-16(25)22-19(24)26/h7-8,13,23H,3-6,9-12H2,1-2H3,(H,22,25,26)/t13-/m0/s1 |
| InChIKey | NIBQQNUPJBYVPN-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|