C16H25NO7S2 — CID 146219495
2-[3-[[3-(cyclopropylmethoxy)phenyl]sulfonylamino]propoxy]ethyl methanesulfonate (PubChem CID 146219495) has the molecular formula C16H25NO7S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[3-[[3-(cyclopropylmethoxy)phenyl]sulfonylamino]propoxy]ethyl methanesulfonate.
| Compound Name | 2-[3-[[3-(cyclopropylmethoxy)phenyl]sulfonylamino]propoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 146219495 |
| Molecular Formula | C16H25NO7S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[3-[[3-(cyclopropylmethoxy)phenyl]sulfonylamino]propoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCCNS(=O)(=O)c1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C16H25NO7S2/c1-25(18,19)24-11-10-22-9-3-8-17-26(20,21)16-5-2-4-15(12-16)23-13-14-6-7-14/h2,4-5,12,14,17H,3,6-11,13H2,1H3 |
| InChIKey | RGFGYRKLXVROEI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|