C25H36FN3O5S — CID 148703452
1-[5-[[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]piperidin-4-yl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione (PubChem CID 148703452) has the molecular formula C25H36FN3O5S and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-[5-[[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]piperidin-4-yl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[5-[[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]piperidin-4-yl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 148703452 |
| Molecular Formula | C25H36FN3O5S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 1-[5-[[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]piperidin-4-yl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(CCCCCS(=O)(=O)CC2(c3ccc(F)c(OCC4CC4)c3)CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C25H36FN3O5S/c26-21-7-6-20(16-22(21)34-17-19-4-5-19)25(9-11-27-12-10-25)18-35(32,33)15-3-1-2-13-29-14-8-23(30)28-24(29)31/h6-7,16,19,27H,1-5,8-15,17-18H2,(H,28,30,31) |
| InChIKey | NVUVCVSRHYURSI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|