C24H36FN5O3 — CID 142360581
1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione (PubChem CID 142360581) has the molecular formula C24H36FN5O3 and a molecular weight of 461.58 g/mol. Its IUPAC name is 1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142360581 |
| Molecular Formula | C24H36FN5O3 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
| SMILES | CN1CCC(NNCCCCCN2CC(=O)NC2=O)(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C24H36FN5O3/c1-29-13-9-24(10-14-29,19-7-8-20(25)21(15-19)33-17-18-5-6-18)28-26-11-3-2-4-12-30-16-22(31)27-23(30)32/h7-8,15,18,26,28H,2-6,9-14,16-17H2,1H3,(H,27,31,32) |
| InChIKey | QNNRMEYCDALBFG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|