C23H34FN3O4 — CID 134553917
1-[7-[[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]amino]heptyl]imidazolidine-2,4-dione (PubChem CID 134553917) has the molecular formula C23H34FN3O4 and a molecular weight of 435.54 g/mol. Its IUPAC name is 1-[7-[[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]amino]heptyl]imidazolidine-2,4-dione.
| Compound Name | 1-[7-[[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]amino]heptyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134553917 |
| Molecular Formula | C23H34FN3O4 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[7-[[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]amino]heptyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(O)COc1cc(C2(NCCCCCCCN3CC(=O)NC3=O)CC2)ccc1F |
| InChI | InChI=1S/C23H34FN3O4/c1-22(2,30)16-31-19-14-17(8-9-18(19)24)23(10-11-23)25-12-6-4-3-5-7-13-27-15-20(28)26-21(27)29/h8-9,14,25,30H,3-7,10-13,15-16H2,1-2H3,(H,26,28,29) |
| InChIKey | XRHYHGFBLIIGMI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|