C26H32N2O5S — CID 123847966
N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(8-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)pent-3-ene-1-sulfonamide (PubChem CID 123847966) has the molecular formula C26H32N2O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(8-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)pent-3-ene-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(8-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)pent-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 123847966 |
| Molecular Formula | C26H32N2O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(8-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)pent-3-ene-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCC=CCC1Cc2cccc(O)c2NC1=O)c1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C26H32N2O5S/c1-18(20-8-5-10-23(16-20)33-17-19-12-13-19)28-34(31,32)14-4-2-3-7-22-15-21-9-6-11-24(29)25(21)27-26(22)30/h2-3,5-6,8-11,16,18-19,22,28-29H,4,7,12-15,17H2,1H3,(H,27,30) |
| InChIKey | DNRYSCACVQHJBL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|