C22H30N2O6S2 — CID 123907704
N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-N-(methoxymethyl)pent-3-ene-1-sulfonamide (PubChem CID 123907704) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-N-(methoxymethyl)pent-3-ene-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-N-(methoxymethyl)pent-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 123907704 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)phenyl]ethyl]-5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-N-(methoxymethyl)pent-3-ene-1-sulfonamide |
| SMILES | COCN(C(C)c1cccc(OCC2CC2)c1)S(=O)(=O)CCC=CCc1sc(=O)[nH]c1O |
| InChI | InChI=1S/C22H30N2O6S2/c1-16(18-7-6-8-19(13-18)30-14-17-10-11-17)24(15-29-2)32(27,28)12-5-3-4-9-20-21(25)23-22(26)31-20/h3-4,6-8,13,16-17,25H,5,9-12,14-15H2,1-2H3,(H,23,26) |
| InChIKey | XPSWAGGCKARAMS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|