C23H32N2O5S — CID 134543324
(E)-N-[2-[3-(cyclopropylmethoxy)phenyl]propan-2-yl]-5-[(3S)-2,6-dioxopiperidin-3-yl]pent-3-ene-1-sulfonamide (PubChem CID 134543324) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is (E)-N-[2-[3-(cyclopropylmethoxy)phenyl]propan-2-yl]-5-[(3S)-2,6-dioxopiperidin-3-yl]pent-3-ene-1-sulfonamide.
| Compound Name | (E)-N-[2-[3-(cyclopropylmethoxy)phenyl]propan-2-yl]-5-[(3S)-2,6-dioxopiperidin-3-yl]pent-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 134543324 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (E)-N-[2-[3-(cyclopropylmethoxy)phenyl]propan-2-yl]-5-[(3S)-2,6-dioxopiperidin-3-yl]pent-3-ene-1-sulfonamide |
| SMILES | CC(C)(NS(=O)(=O)CC/C=C/C[C@@H]1CCC(=O)NC1=O)c1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C23H32N2O5S/c1-23(2,19-8-6-9-20(15-19)30-16-17-10-11-17)25-31(28,29)14-5-3-4-7-18-12-13-21(26)24-22(18)27/h3-4,6,8-9,15,17-18,25H,5,7,10-14,16H2,1-2H3,(H,24,26,27)/b4-3+/t18-/m1/s1 |
| InChIKey | GMEWROPESXAJAN-OAJJDEHYSA-N |
| XLogP | 3.02 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|