C22H29N3O5S — CID 153312136
(E)-N-[1-[3-(cyclopropylmethoxy)phenyl]cyclopropyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pent-3-ene-1-sulfonamide (PubChem CID 153312136) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is (E)-N-[1-[3-(cyclopropylmethoxy)phenyl]cyclopropyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pent-3-ene-1-sulfonamide.
| Compound Name | (E)-N-[1-[3-(cyclopropylmethoxy)phenyl]cyclopropyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pent-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 153312136 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (E)-N-[1-[3-(cyclopropylmethoxy)phenyl]cyclopropyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pent-3-ene-1-sulfonamide |
| SMILES | C[C@H]1C(=O)NC(=O)N1C/C=C/CCS(=O)(=O)NC1(c2cccc(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C22H29N3O5S/c1-16-20(26)23-21(27)25(16)12-3-2-4-13-31(28,29)24-22(10-11-22)18-6-5-7-19(14-18)30-15-17-8-9-17/h2-3,5-7,14,16-17,24H,4,8-13,15H2,1H3,(H,23,26,27)/b3-2+/t16-/m0/s1 |
| InChIKey | NAYHSWPGJJHFMH-KZSQQDEKSA-N |
| XLogP | 2.27 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|