C20H27F2N3O5S — CID 155370244
N-[[(E)-5-[[1-[3-(2,2-difluoroethoxy)phenyl]cyclopropyl]sulfamoyl]pent-2-enyl]-ethylcarbamoyl]formamide (PubChem CID 155370244) has the molecular formula C20H27F2N3O5S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[[(E)-5-[[1-[3-(2,2-difluoroethoxy)phenyl]cyclopropyl]sulfamoyl]pent-2-enyl]-ethylcarbamoyl]formamide.
| Compound Name | N-[[(E)-5-[[1-[3-(2,2-difluoroethoxy)phenyl]cyclopropyl]sulfamoyl]pent-2-enyl]-ethylcarbamoyl]formamide |
|---|---|
| PubChem CID | 155370244 |
| Molecular Formula | C20H27F2N3O5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[[(E)-5-[[1-[3-(2,2-difluoroethoxy)phenyl]cyclopropyl]sulfamoyl]pent-2-enyl]-ethylcarbamoyl]formamide |
| SMILES | CCN(C/C=C/CCS(=O)(=O)NC1(c2cccc(OCC(F)F)c2)CC1)C(=O)NC=O |
| InChI | InChI=1S/C20H27F2N3O5S/c1-2-25(19(27)23-15-26)11-4-3-5-12-31(28,29)24-20(9-10-20)16-7-6-8-17(13-16)30-14-18(21)22/h3-4,6-8,13,15,18,24H,2,5,9-12,14H2,1H3,(H,23,26,27)/b4-3+ |
| InChIKey | IJJQJBGPAXYBCK-ONEGZZNKSA-N |
| XLogP | 2.37 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|