C22H32N2O5S — CID 140946039
(2R)-2-[3-(cyclopropylmethoxy)phenyl]-7-(2,6-dioxopiperidin-3-yl)heptane-3-sulfonamide (PubChem CID 140946039) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is (2R)-2-[3-(cyclopropylmethoxy)phenyl]-7-(2,6-dioxopiperidin-3-yl)heptane-3-sulfonamide.
| Compound Name | (2R)-2-[3-(cyclopropylmethoxy)phenyl]-7-(2,6-dioxopiperidin-3-yl)heptane-3-sulfonamide |
|---|---|
| PubChem CID | 140946039 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (2R)-2-[3-(cyclopropylmethoxy)phenyl]-7-(2,6-dioxopiperidin-3-yl)heptane-3-sulfonamide |
| SMILES | C[C@H](c1cccc(OCC2CC2)c1)C(CCCCC1CCC(=O)NC1=O)S(N)(=O)=O |
| InChI | InChI=1S/C22H32N2O5S/c1-15(18-6-4-7-19(13-18)29-14-16-9-10-16)20(30(23,27)28)8-3-2-5-17-11-12-21(25)24-22(17)26/h4,6-7,13,15-17,20H,2-3,5,8-12,14H2,1H3,(H2,23,27,28)(H,24,25,26)/t15-,17?,20?/m1/s1 |
| InChIKey | KCORKIPOBVCSJK-XRTORIHISA-N |
| XLogP | 2.85 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|