C20H28FN3O3S — CID 162532103
1-[(E)-6-[[3-(2-fluoropropoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]imidazolidine-2,4-dione (PubChem CID 162532103) has the molecular formula C20H28FN3O3S and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[(E)-6-[[3-(2-fluoropropoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-6-[[3-(2-fluoropropoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162532103 |
| Molecular Formula | C20H28FN3O3S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[(E)-6-[[3-(2-fluoropropoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]imidazolidine-2,4-dione |
| SMILES | CC(F)COc1cccc(SNC(C)(C)CCC/C=C/N2CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C20H28FN3O3S/c1-15(21)14-27-16-8-7-9-17(12-16)28-23-20(2,3)10-5-4-6-11-24-13-18(25)22-19(24)26/h6-9,11-12,15,23H,4-5,10,13-14H2,1-3H3,(H,22,25,26)/b11-6+ |
| InChIKey | FDCARRHAVQCRTI-IZZDOVSWSA-N |
| XLogP | 4.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|