About 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene
1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene (PubChem CID 21484319) has the molecular formula C18H30O2S2
and a molecular weight of 342.57 g/mol. Its IUPAC name is 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene.
Molecular Properties
| Compound Name | 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene |
| PubChem CID | 21484319 |
| Molecular Formula | C18H30O2S2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene |
| SMILES | CCOC(C)(C)CCCC(C)CCOc1cccc(SS)c1 |
| InChI | InChI=1S/C18H30O2S2/c1-5-20-18(3,4)12-7-8-15(2)11-13-19-16-9-6-10-17(14-16)22-21/h6,9-10,14-15,21H,5,7-8,11-13H2,1-4H3 |
| InChIKey | PZOLJGHYKYYSCR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene?
The IUPAC name of 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene (CID 21484319) is 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene.
What is the SMILES notation for 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene?
The canonical SMILES for 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene is CCOC(C)(C)CCCC(C)CCOc1cccc(SS)c1.
What is the InChIKey of 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene?
The InChIKey is PZOLJGHYKYYSCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O2S2/c1-5-20-18(3,4)12-7-8-15(2)11-13-19-16-9-6-10-17(14-16)22-21/h6,9-10,14-15,21H,5,7-8,11-13H2,1-4H3.
What are the key properties of 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene?
1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene has a molecular weight of 342.57 g/mol, XLogP of 6.01, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)-3-(7-ethoxy-3,7-dimethyloctoxy)benzene is sourced from PubChem (CID 21484319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).