C24H42O2 — CID 22749811
2-(7-ethoxy-3,7-dimethyloctoxy)-1,3-di(propan-2-yl)benzene (PubChem CID 22749811) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-(7-ethoxy-3,7-dimethyloctoxy)-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(7-ethoxy-3,7-dimethyloctoxy)-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 22749811 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 2-(7-ethoxy-3,7-dimethyloctoxy)-1,3-di(propan-2-yl)benzene |
| SMILES | CCOC(C)(C)CCCC(C)CCOc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C24H42O2/c1-9-26-24(7,8)16-11-12-20(6)15-17-25-23-21(18(2)3)13-10-14-22(23)19(4)5/h10,13-14,18-20H,9,11-12,15-17H2,1-8H3 |
| InChIKey | DCKPLMIPEVNMPF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |