C20H36NO+ — CID 2250093
4-[2,6-di(propan-2-yl)phenoxy]butyl-diethylazanium (PubChem CID 2250093) has the molecular formula C20H36NO+ and a molecular weight of 306.51 g/mol. Its IUPAC name is 4-[2,6-di(propan-2-yl)phenoxy]butyl-diethylazanium.
| Compound Name | 4-[2,6-di(propan-2-yl)phenoxy]butyl-diethylazanium |
|---|---|
| PubChem CID | 2250093 |
| Molecular Formula | C20H36NO+ |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 4-[2,6-di(propan-2-yl)phenoxy]butyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCCOc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H35NO/c1-7-21(8-2)14-9-10-15-22-20-18(16(3)4)12-11-13-19(20)17(5)6/h11-13,16-17H,7-10,14-15H2,1-6H3/p+1 |
| InChIKey | YCVCNSPSWJEPSQ-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|