C19H31NO5 — CID 22749794
1-(7-ethoxy-3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene (PubChem CID 22749794) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-(7-ethoxy-3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene.
| Compound Name | 1-(7-ethoxy-3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene |
|---|---|
| PubChem CID | 22749794 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-(7-ethoxy-3,7-dimethyloctoxy)-2-methoxy-4-nitrobenzene |
| SMILES | CCOC(C)(C)CCCC(C)CCOc1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H31NO5/c1-6-25-19(3,4)12-7-8-15(2)11-13-24-17-10-9-16(20(21)22)14-18(17)23-5/h9-10,14-15H,6-8,11-13H2,1-5H3 |
| InChIKey | DUCUZVQSRZSEAZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|