C17H37NO — CID 150200796
12-ethoxy-2,12-dimethyltridecan-1-amine (PubChem CID 150200796) has the molecular formula C17H37NO and a molecular weight of 271.49 g/mol. Its IUPAC name is 12-ethoxy-2,12-dimethyltridecan-1-amine.
| Compound Name | 12-ethoxy-2,12-dimethyltridecan-1-amine |
|---|---|
| PubChem CID | 150200796 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | 12-ethoxy-2,12-dimethyltridecan-1-amine |
| SMILES | CCOC(C)(C)CCCCCCCCCC(C)CN |
| InChI | InChI=1S/C17H37NO/c1-5-19-17(3,4)14-12-10-8-6-7-9-11-13-16(2)15-18/h16H,5-15,18H2,1-4H3 |
| InChIKey | FPLATHOQUHGUHH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|